C26H27N3O2S — CID 5130639
N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-4-butoxybenzamide (PubChem CID 5130639) has the molecular formula C26H27N3O2S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-4-butoxybenzamide.
| Compound Name | N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-4-butoxybenzamide |
|---|---|
| PubChem CID | 5130639 |
| Molecular Formula | C26H27N3O2S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-(6-benzyl-3-cyano-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)Nc2sc3c(c2C#N)CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C26H27N3O2S/c1-2-3-15-31-21-11-9-20(10-12-21)25(30)28-26-23(16-27)22-13-14-29(18-24(22)32-26)17-19-7-5-4-6-8-19/h4-12H,2-3,13-15,17-18H2,1H3,(H,28,30) |
| InChIKey | XKFBRTYLQSZLCJ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 65.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|