C27H31ClN2O4S — CID 16806183
methyl 6-benzyl-2-[(4-butoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate;hydrochloride (PubChem CID 16806183) has the molecular formula C27H31ClN2O4S and a molecular weight of 515.08 g/mol. Its IUPAC name is methyl 6-benzyl-2-[(4-butoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate;hydrochloride.
| Compound Name | methyl 6-benzyl-2-[(4-butoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 16806183 |
| Molecular Formula | C27H31ClN2O4S |
| Molecular Weight | 515.08 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | methyl 6-benzyl-2-[(4-butoxybenzoyl)amino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carboxylate;hydrochloride |
| SMILES | CCCCOc1ccc(C(=O)Nc2sc3c(c2C(=O)OC)CCN(Cc2ccccc2)C3)cc1.Cl |
| InChI | InChI=1S/C27H30N2O4S.ClH/c1-3-4-16-33-21-12-10-20(11-13-21)25(30)28-26-24(27(31)32-2)22-14-15-29(18-23(22)34-26)17-19-8-6-5-7-9-19;/h5-13H,3-4,14-18H2,1-2H3,(H,28,30);1H |
| InChIKey | PKQHYZZWSOXREF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.08 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|