C25H27FO3 — CID 21409753
3-[5-(4-fluorophenyl)pentan-2-yl]-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 21409753) has the molecular formula C25H27FO3 and a molecular weight of 394.49 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)pentan-2-yl]-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-[5-(4-fluorophenyl)pentan-2-yl]-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 21409753 |
| Molecular Formula | C25H27FO3 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | 3-[5-(4-fluorophenyl)pentan-2-yl]-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CC1CCc2c(c3c(O)cc(C(C)CCCc4ccc(F)cc4)cc3oc2=O)C1 |
| InChI | InChI=1S/C25H27FO3/c1-15-6-11-20-21(12-15)24-22(27)13-18(14-23(24)29-25(20)28)16(2)4-3-5-17-7-9-19(26)10-8-17/h7-10,13-16,27H,3-6,11-12H2,1-2H3 |
| InChIKey | QWZVQPRREQJICN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|