C19H25ClFNO2 — CID 110186082
3-(4-fluorophenyl)propyl-[1-hydroxy-1-(3-hydroxy-4-methylphenyl)propan-2-yl]azanium chloride (PubChem CID 110186082) has the molecular formula C19H25ClFNO2 and a molecular weight of 353.87 g/mol. Its IUPAC name is 3-(4-fluorophenyl)propyl-[1-hydroxy-1-(3-hydroxy-4-methylphenyl)propan-2-yl]azanium chloride.
| Compound Name | 3-(4-fluorophenyl)propyl-[1-hydroxy-1-(3-hydroxy-4-methylphenyl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110186082 |
| Molecular Formula | C19H25ClFNO2 |
| Molecular Weight | 353.87 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-(4-fluorophenyl)propyl-[1-hydroxy-1-(3-hydroxy-4-methylphenyl)propan-2-yl]azanium chloride |
| SMILES | Cc1ccc(C(O)C(C)[NH2+]CCCc2ccc(F)cc2)cc1O.[Cl-] |
| InChI | InChI=1S/C19H24FNO2.ClH/c1-13-5-8-16(12-18(13)22)19(23)14(2)21-11-3-4-15-6-9-17(20)10-7-15;/h5-10,12,14,19,21-23H,3-4,11H2,1-2H3;1H |
| InChIKey | JGQOSKWXYPWPGU-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 57.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.87 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|