C21H30ClNO4 — CID 110185530
3-(2,3-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-hydroxy-3-methylphenyl)propan-2-yl]azanium chloride (PubChem CID 110185530) has the molecular formula C21H30ClNO4 and a molecular weight of 395.93 g/mol. Its IUPAC name is 3-(2,3-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-hydroxy-3-methylphenyl)propan-2-yl]azanium chloride.
| Compound Name | 3-(2,3-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-hydroxy-3-methylphenyl)propan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 110185530 |
| Molecular Formula | C21H30ClNO4 |
| Molecular Weight | 395.93 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 3-(2,3-dimethoxyphenyl)propyl-[1-hydroxy-1-(4-hydroxy-3-methylphenyl)propan-2-yl]azanium chloride |
| SMILES | COc1cccc(CCC[NH2+]C(C)C(O)c2ccc(O)c(C)c2)c1OC.[Cl-] |
| InChI | InChI=1S/C21H29NO4.ClH/c1-14-13-17(10-11-18(14)23)20(24)15(2)22-12-6-8-16-7-5-9-19(25-3)21(16)26-4;/h5,7,9-11,13,15,20,22-24H,6,8,12H2,1-4H3;1H |
| InChIKey | FDTDNTLORUXIDU-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 75.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.93 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|