C21H28O4 — CID 10066105
3-heptan-2-yloxy-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one (PubChem CID 10066105) has the molecular formula C21H28O4 and a molecular weight of 344.45 g/mol. Its IUPAC name is 3-heptan-2-yloxy-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one.
| Compound Name | 3-heptan-2-yloxy-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 10066105 |
| Molecular Formula | C21H28O4 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 3-heptan-2-yloxy-1-hydroxy-9-methyl-7,8,9,10-tetrahydrobenzo[c]chromen-6-one |
| SMILES | CCCCCC(C)Oc1cc(O)c2c3c(c(=O)oc2c1)CCC(C)C3 |
| InChI | InChI=1S/C21H28O4/c1-4-5-6-7-14(3)24-15-11-18(22)20-17-10-13(2)8-9-16(17)21(23)25-19(20)12-15/h11-14,22H,4-10H2,1-3H3 |
| InChIKey | AKCRULYJVPXKFK-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|