C22H30O3 — CID 88828246
9-hydroxy-2-methyl-7-(3-methyloctyl)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one (PubChem CID 88828246) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is 9-hydroxy-2-methyl-7-(3-methyloctyl)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one.
| Compound Name | 9-hydroxy-2-methyl-7-(3-methyloctyl)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
|---|---|
| PubChem CID | 88828246 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | 9-hydroxy-2-methyl-7-(3-methyloctyl)-2,3-dihydro-1H-cyclopenta[c]chromen-4-one |
| SMILES | CCCCCC(C)CCc1cc(O)c2c3c(c(=O)oc2c1)CC(C)C3 |
| InChI | InChI=1S/C22H30O3/c1-4-5-6-7-14(2)8-9-16-12-19(23)21-17-10-15(3)11-18(17)22(24)25-20(21)13-16/h12-15,23H,4-11H2,1-3H3 |
| InChIKey | LHNMDDAYWRACJF-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|