C18H27NO3 — CID 136762836
4-[(2R)-2-hydroxypropyl]imino-2-methyl-7-pentyl-2,3-dihydrochromen-5-ol (PubChem CID 136762836) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 4-[(2R)-2-hydroxypropyl]imino-2-methyl-7-pentyl-2,3-dihydrochromen-5-ol.
| Compound Name | 4-[(2R)-2-hydroxypropyl]imino-2-methyl-7-pentyl-2,3-dihydrochromen-5-ol |
|---|---|
| PubChem CID | 136762836 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 4-[(2R)-2-hydroxypropyl]imino-2-methyl-7-pentyl-2,3-dihydrochromen-5-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)C/C2=N\C[C@@H](C)O |
| InChI | InChI=1S/C18H27NO3/c1-4-5-6-7-14-9-16(21)18-15(19-11-12(2)20)8-13(3)22-17(18)10-14/h9-10,12-13,20-21H,4-8,11H2,1-3H3/b19-15+/t12-,13?/m1/s1 |
| InChIKey | CBANLXXNVJWKBO-ZBBWAUFHSA-N |
| XLogP | 3.47 |
| TPSA | 62.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|