C21H32O2 — CID 153099733
(2aR,3S,8bR)-2-ethyl-1,1,3-trimethyl-6-pentyl-2,2a,3,8b-tetrahydrocyclobuta[c]chromen-8-ol (PubChem CID 153099733) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (2aR,3S,8bR)-2-ethyl-1,1,3-trimethyl-6-pentyl-2,2a,3,8b-tetrahydrocyclobuta[c]chromen-8-ol.
| Compound Name | (2aR,3S,8bR)-2-ethyl-1,1,3-trimethyl-6-pentyl-2,2a,3,8b-tetrahydrocyclobuta[c]chromen-8-ol |
|---|---|
| PubChem CID | 153099733 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2aR,3S,8bR)-2-ethyl-1,1,3-trimethyl-6-pentyl-2,2a,3,8b-tetrahydrocyclobuta[c]chromen-8-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)O[C@@H](C)[C@@H]1C(CC)C(C)(C)[C@H]21 |
| InChI | InChI=1S/C21H32O2/c1-6-8-9-10-14-11-16(22)19-17(12-14)23-13(3)18-15(7-2)21(4,5)20(18)19/h11-13,15,18,20,22H,6-10H2,1-5H3/t13-,15?,18+,20-/m0/s1 |
| InChIKey | VQVANJBBIADGES-FJQGMXSFSA-N |
| XLogP | 5.67 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|