C22H32O2 — CID 164591595
(6aR,10aR)-6,6,8,9-tetramethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 164591595) has the molecular formula C22H32O2 and a molecular weight of 328.50 g/mol. Its IUPAC name is (6aR,10aR)-6,6,8,9-tetramethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-6,6,8,9-tetramethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 164591595 |
| Molecular Formula | C22H32O2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.24 |
| IUPAC Name | (6aR,10aR)-6,6,8,9-tetramethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CC(C)C(C)=C[C@@H]21 |
| InChI | InChI=1S/C22H32O2/c1-6-7-8-9-16-12-19(23)21-17-10-14(2)15(3)11-18(17)22(4,5)24-20(21)13-16/h10,12-13,15,17-18,23H,6-9,11H2,1-5H3/t15?,17-,18-/m1/s1 |
| InChIKey | UKXVFMRJNPYGNP-HSFDIDPMSA-N |
| XLogP | 5.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|