C19H26O3 — CID 162657405
(6aR,8S,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol (PubChem CID 162657405) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (6aR,8S,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol.
| Compound Name | (6aR,8S,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol |
|---|---|
| PubChem CID | 162657405 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (6aR,8S,10aR)-6,6,9-trimethyl-3-propyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,8-diol |
| SMILES | CCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]1C[C@H](O)C(C)=C[C@@H]21 |
| InChI | InChI=1S/C19H26O3/c1-5-6-12-8-16(21)18-13-7-11(2)15(20)10-14(13)19(3,4)22-17(18)9-12/h7-9,13-15,20-21H,5-6,10H2,1-4H3/t13-,14-,15+/m1/s1 |
| InChIKey | JXXVDKGGZIPBOC-KFWWJZLASA-N |
| XLogP | 3.93 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|