C19H26O2 — CID 167537854
(6aR,10aR)-6-methyl-3-propyl-6,9-bis(trideuteriomethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 167537854) has the molecular formula C19H26O2 and a molecular weight of 292.45 g/mol. Its IUPAC name is (6aR,10aR)-6-methyl-3-propyl-6,9-bis(trideuteriomethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | (6aR,10aR)-6-methyl-3-propyl-6,9-bis(trideuteriomethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 167537854 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 292.45 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (6aR,10aR)-6-methyl-3-propyl-6,9-bis(trideuteriomethyl)-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | [2H]C([2H])([2H])C1=C[C@H]2c3c(O)cc(CCC)cc3OC(C)(C([2H])([2H])[2H])[C@@H]2CC1 |
| InChI | InChI=1S/C19H26O2/c1-5-6-13-10-16(20)18-14-9-12(2)7-8-15(14)19(3,4)21-17(18)11-13/h9-11,14-15,20H,5-8H2,1-4H3/t14-,15-/m1/s1/i2D3,3D3/t14-,15-,19? |
| InChIKey | ZROLHBHDLIHEMS-HMSIURTJSA-N |
| XLogP | 4.96 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|