C20H28O3 — CID 169258963
6,9-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,6-diol (PubChem CID 169258963) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 6,9-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,6-diol.
| Compound Name | 6,9-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,6-diol |
|---|---|
| PubChem CID | 169258963 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 6,9-dimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-1,6-diol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(O)C1CCC(C)=CC21 |
| InChI | InChI=1S/C20H28O3/c1-4-5-6-7-14-11-17(21)19-15-10-13(2)8-9-16(15)20(3,22)23-18(19)12-14/h10-12,15-16,21-22H,4-9H2,1-3H3 |
| InChIKey | NIBMZWXYVNTLQQ-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|