C43H62O6 — CID 159446525
(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol;carbon dioxide;2-[(1S,6R)-3,6-dimethylcyclohex-2-en-1-yl]-1,3-dimethoxy-5-pentylbenzene (PubChem CID 159446525) has the molecular formula C43H62O6 and a molecular weight of 674.96 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol;carbon dioxide;2-[(1S,6R)-3,6-dimethylcyclohex-2-en-1-yl]-1,3-dimethoxy-5-pentylbenzene.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol;carbon dioxide;2-[(1S,6R)-3,6-dimethylcyclohex-2-en-1-yl]-1,3-dimethoxy-5-pentylbenzene |
|---|---|
| PubChem CID | 159446525 |
| Molecular Formula | C43H62O6 |
| Molecular Weight | 674.96 g/mol |
| Exact Mass | 674.45 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol;carbon dioxide;2-[(1S,6R)-3,6-dimethylcyclohex-2-en-1-yl]-1,3-dimethoxy-5-pentylbenzene |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@@H]1CCC(C)=C[C@@H]21.CCCCCc1cc(OC)c([C@@H]2C=C(C)CC[C@H]2C)c(OC)c1.O=C=O |
| InChI | InChI=1S/C21H30O2.C21H32O2.CO2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15;1-6-7-8-9-17-13-19(22-4)21(20(14-17)23-5)18-12-15(2)10-11-16(18)3;2-1-3/h11-13,16-17,22H,5-10H2,1-4H3;12-14,16,18H,6-11H2,1-5H3;/t16-,17-;16-,18-;/m11./s1 |
| InChIKey | LSVDHSRTEWODCL-BAFJSFIKSA-N |
| XLogP | 11.05 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.96 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|