C22H34O2 — CID 142136715
6,9-dimethyl-3-pentyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol;ethane (PubChem CID 142136715) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is 6,9-dimethyl-3-pentyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol;ethane.
| Compound Name | 6,9-dimethyl-3-pentyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol;ethane |
|---|---|
| PubChem CID | 142136715 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | 6,9-dimethyl-3-pentyl-6a,7,10,10a-tetrahydro-6H-benzo[c]chromen-1-ol;ethane |
| SMILES | CC.CCCCCc1cc(O)c2c(c1)OC(C)C1CC=C(C)CC21 |
| InChI | InChI=1S/C20H28O2.C2H6/c1-4-5-6-7-15-11-18(21)20-17-10-13(2)8-9-16(17)14(3)22-19(20)12-15;1-2/h8,11-12,14,16-17,21H,4-7,9-10H2,1-3H3;1-2H3 |
| InChIKey | SLKUPBKWFQJADV-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|