C19H23F2NO5 — CID 118620598
5-[(6aR,10aR)-6,6-difluoro-1-hydroxy-9-methyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]pentyl nitrate (PubChem CID 118620598) has the molecular formula C19H23F2NO5 and a molecular weight of 383.39 g/mol. Its IUPAC name is 5-[(6aR,10aR)-6,6-difluoro-1-hydroxy-9-methyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]pentyl nitrate.
| Compound Name | 5-[(6aR,10aR)-6,6-difluoro-1-hydroxy-9-methyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]pentyl nitrate |
|---|---|
| PubChem CID | 118620598 |
| Molecular Formula | C19H23F2NO5 |
| Molecular Weight | 383.39 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 5-[(6aR,10aR)-6,6-difluoro-1-hydroxy-9-methyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]pentyl nitrate |
| SMILES | CC1=CC[C@@H]2[C@@H](C1)c1c(O)cc(CCCCCO[N+](=O)[O-])cc1OC2(F)F |
| InChI | InChI=1S/C19H23F2NO5/c1-12-6-7-15-14(9-12)18-16(23)10-13(11-17(18)27-19(15,20)21)5-3-2-4-8-26-22(24)25/h6,10-11,14-15,23H,2-5,7-9H2,1H3/t14-,15-/m1/s1 |
| InChIKey | KQSOCGLHAFAVKF-HUUCEWRRSA-N |
| XLogP | 4.74 |
| TPSA | 81.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.39 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|