C28H38O5S — CID 24837520
4-methylbenzenesulfonic acid;6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol (PubChem CID 24837520) has the molecular formula C28H38O5S and a molecular weight of 486.67 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol.
| Compound Name | 4-methylbenzenesulfonic acid;6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 24837520 |
| Molecular Formula | C28H38O5S |
| Molecular Weight | 486.67 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 4-methylbenzenesulfonic acid;6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)C1CC=C(C)CC21.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C21H30O2.C7H8O3S/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15;1-6-2-4-7(5-3-6)11(8,9)10/h9,12-13,16-17,22H,5-8,10-11H2,1-4H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | CGKSYEJVRHMFAL-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.67 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|