C42H54O4 — CID 137474886
6-[6-[(6aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hexyl]-6,9-dimethyl-3-pentylbenzo[c]chromen-1-ol (PubChem CID 137474886) has the molecular formula C42H54O4 and a molecular weight of 622.89 g/mol. Its IUPAC name is 6-[6-[(6aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hexyl]-6,9-dimethyl-3-pentylbenzo[c]chromen-1-ol.
| Compound Name | 6-[6-[(6aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hexyl]-6,9-dimethyl-3-pentylbenzo[c]chromen-1-ol |
|---|---|
| PubChem CID | 137474886 |
| Molecular Formula | C42H54O4 |
| Molecular Weight | 622.89 g/mol |
| Exact Mass | 622.40 |
| IUPAC Name | 6-[6-[(6aR)-1-hydroxy-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl]hexyl]-6,9-dimethyl-3-pentylbenzo[c]chromen-1-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(CCCCCCc1cc(O)c3c(c1)OC(C)(C)[C@@H]1CC=C(C)CC31)c1ccc(C)cc1-2 |
| InChI | InChI=1S/C42H54O4/c1-7-8-11-14-29-23-36(44)40-32-22-28(3)17-19-34(32)42(6,46-38(40)26-29)20-13-10-9-12-15-30-24-35(43)39-31-21-27(2)16-18-33(31)41(4,5)45-37(39)25-30/h16-17,19,22-26,31,33,43-44H,7-15,18,20-21H2,1-6H3/t31?,33-,42?/m1/s1 |
| InChIKey | FCNVPYWSAVDLDR-GULIXYOLSA-N |
| XLogP | 11.22 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.89 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|