C23H34O — CID 168909021
1,2,6,6,9-pentamethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene (PubChem CID 168909021) has the molecular formula C23H34O and a molecular weight of 326.52 g/mol. Its IUPAC name is 1,2,6,6,9-pentamethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene.
| Compound Name | 1,2,6,6,9-pentamethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 168909021 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 1,2,6,6,9-pentamethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromene |
| SMILES | CCCCCc1cc2c(c(C)c1C)C1CC(C)=CCC1C(C)(C)O2 |
| InChI | InChI=1S/C23H34O/c1-7-8-9-10-18-14-21-22(17(4)16(18)3)19-13-15(2)11-12-20(19)23(5,6)24-21/h11,14,19-20H,7-10,12-13H2,1-6H3 |
| InChIKey | RCQBDAKMSLJXBC-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|