C30H44O5 — CID 175112414
[(6aR,10aR)-1-(2,2-dimethylpropanoyloxy)-2,6,6,9-tetramethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl] octanoate (PubChem CID 175112414) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is [(6aR,10aR)-1-(2,2-dimethylpropanoyloxy)-2,6,6,9-tetramethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl] octanoate.
| Compound Name | [(6aR,10aR)-1-(2,2-dimethylpropanoyloxy)-2,6,6,9-tetramethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl] octanoate |
|---|---|
| PubChem CID | 175112414 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | [(6aR,10aR)-1-(2,2-dimethylpropanoyloxy)-2,6,6,9-tetramethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-3-yl] octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc2c(c(OC(=O)C(C)(C)C)c1C)[C@@H]1CC(C)=CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C30H44O5/c1-9-10-11-12-13-14-25(31)33-23-18-24-26(27(20(23)3)34-28(32)29(4,5)6)21-17-19(2)15-16-22(21)30(7,8)35-24/h15,18,21-22H,9-14,16-17H2,1-8H3/t21-,22-/m1/s1 |
| InChIKey | UFOMCVWZAWYYLF-FGZHOGPDSA-N |
| XLogP | 7.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|