C29H47O5P — CID 10720372
[(6aR,10aR)-6,6,9-trimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] diethyl phosphate (PubChem CID 10720372) has the molecular formula C29H47O5P and a molecular weight of 506.66 g/mol. Its IUPAC name is [(6aR,10aR)-6,6,9-trimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] diethyl phosphate.
| Compound Name | [(6aR,10aR)-6,6,9-trimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] diethyl phosphate |
|---|---|
| PubChem CID | 10720372 |
| Molecular Formula | C29H47O5P |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.32 |
| IUPAC Name | [(6aR,10aR)-6,6,9-trimethyl-3-(2-methyloctan-2-yl)-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-yl] diethyl phosphate |
| SMILES | CCCCCCC(C)(C)c1cc2c(c(OP(=O)(OCC)OCC)c1)[C@@H]1CC(C)=CC[C@H]1C(C)(C)O2 |
| InChI | InChI=1S/C29H47O5P/c1-9-12-13-14-17-28(5,6)22-19-25-27(26(20-22)34-35(30,31-10-2)32-11-3)23-18-21(4)15-16-24(23)29(7,8)33-25/h15,19-20,23-24H,9-14,16-18H2,1-8H3/t23-,24-/m1/s1 |
| InChIKey | XRKWHUJWNHCGIL-DNQXCXABSA-N |
| XLogP | 9.11 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|