C23H36O2 — CID 129213117
(1R,11S)-1,9,10,10,14-pentamethyl-5-pentyl-2-oxatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-7-ol (PubChem CID 129213117) has the molecular formula C23H36O2 and a molecular weight of 344.54 g/mol. Its IUPAC name is (1R,11S)-1,9,10,10,14-pentamethyl-5-pentyl-2-oxatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-7-ol.
| Compound Name | (1R,11S)-1,9,10,10,14-pentamethyl-5-pentyl-2-oxatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-7-ol |
|---|---|
| PubChem CID | 129213117 |
| Molecular Formula | C23H36O2 |
| Molecular Weight | 344.54 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | (1R,11S)-1,9,10,10,14-pentamethyl-5-pentyl-2-oxatricyclo[9.2.1.03,8]tetradeca-3,5,7-trien-7-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)O[C@]1(C)CC[C@@H](C1C)C(C)(C)C2C |
| InChI | InChI=1S/C23H36O2/c1-7-8-9-10-17-13-19(24)21-16(3)22(4,5)18-11-12-23(6,15(18)2)25-20(21)14-17/h13-16,18,24H,7-12H2,1-6H3/t15?,16?,18-,23+/m0/s1 |
| InChIKey | DEKGRIJBKMYKHK-MIRXVNBUSA-N |
| XLogP | 6.45 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|