C22H32O5 — CID 57146987
methyl (6aS,9R,10aS)-1,9-dihydroxy-6,6-dimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-9-carboxylate (PubChem CID 57146987) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is methyl (6aS,9R,10aS)-1,9-dihydroxy-6,6-dimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-9-carboxylate.
| Compound Name | methyl (6aS,9R,10aS)-1,9-dihydroxy-6,6-dimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-9-carboxylate |
|---|---|
| PubChem CID | 57146987 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | methyl (6aS,9R,10aS)-1,9-dihydroxy-6,6-dimethyl-3-pentyl-7,8,10,10a-tetrahydro-6aH-benzo[c]chromene-9-carboxylate |
| SMILES | CCCCCc1cc(O)c2c(c1)OC(C)(C)[C@H]1CC[C@](O)(C(=O)OC)C[C@H]21 |
| InChI | InChI=1S/C22H32O5/c1-5-6-7-8-14-11-17(23)19-15-13-22(25,20(24)26-4)10-9-16(15)21(2,3)27-18(19)12-14/h11-12,15-16,23,25H,5-10,13H2,1-4H3/t15-,16-,22+/m0/s1 |
| InChIKey | IPNUOOXQCOFKON-PONJGIIJSA-N |
| XLogP | 4.08 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|