C21H32O2 — CID 162808630
(8aS,10aR)-6,9,9-trimethyl-3-pentyl-5,6,7,8,8a,10a-hexahydroxanthen-1-ol (PubChem CID 162808630) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (8aS,10aR)-6,9,9-trimethyl-3-pentyl-5,6,7,8,8a,10a-hexahydroxanthen-1-ol.
| Compound Name | (8aS,10aR)-6,9,9-trimethyl-3-pentyl-5,6,7,8,8a,10a-hexahydroxanthen-1-ol |
|---|---|
| PubChem CID | 162808630 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (8aS,10aR)-6,9,9-trimethyl-3-pentyl-5,6,7,8,8a,10a-hexahydroxanthen-1-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)O[C@@H]1CC(C)CC[C@H]1C2(C)C |
| InChI | InChI=1S/C21H32O2/c1-5-6-7-8-15-12-17(22)20-19(13-15)23-18-11-14(2)9-10-16(18)21(20,3)4/h12-14,16,18,22H,5-11H2,1-4H3/t14?,16-,18-/m1/s1 |
| InChIKey | DOBYLUIBUIPINY-NBSGVIAVSA-N |
| XLogP | 5.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|