C21H30O2 — CID 78065083
6,9,9-trimethyl-3-pentyl-5,6,7,10a-tetrahydroxanthen-1-ol (PubChem CID 78065083) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 6,9,9-trimethyl-3-pentyl-5,6,7,10a-tetrahydroxanthen-1-ol.
| Compound Name | 6,9,9-trimethyl-3-pentyl-5,6,7,10a-tetrahydroxanthen-1-ol |
|---|---|
| PubChem CID | 78065083 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 6,9,9-trimethyl-3-pentyl-5,6,7,10a-tetrahydroxanthen-1-ol |
| SMILES | CCCCCc1cc(O)c2c(c1)OC1CC(C)CC=C1C2(C)C |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-17(22)20-19(13-15)23-18-11-14(2)9-10-16(18)21(20,3)4/h10,12-14,18,22H,5-9,11H2,1-4H3 |
| InChIKey | TYOANFOJLIFESI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|