C16H24O2 — CID 59545571
6-heptyl-3-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 59545571) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 6-heptyl-3-methyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-heptyl-3-methyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 59545571 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 6-heptyl-3-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CCCCCCCc1ccc2c(c1)OC(C)CO2 |
| InChI | InChI=1S/C16H24O2/c1-3-4-5-6-7-8-14-9-10-15-16(11-14)18-13(2)12-17-15/h9-11,13H,3-8,12H2,1-2H3 |
| InChIKey | QLXQEQRFGMXIHS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|