C11H15FO2 — CID 144624453
ethane;6-fluoro-3-methyl-2,3-dihydro-1,4-benzodioxine (PubChem CID 144624453) has the molecular formula C11H15FO2 and a molecular weight of 198.24 g/mol. Its IUPAC name is ethane;6-fluoro-3-methyl-2,3-dihydro-1,4-benzodioxine.
| Compound Name | ethane;6-fluoro-3-methyl-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 144624453 |
| Molecular Formula | C11H15FO2 |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | ethane;6-fluoro-3-methyl-2,3-dihydro-1,4-benzodioxine |
| SMILES | CC.CC1COc2ccc(F)cc2O1 |
| InChI | InChI=1S/C9H9FO2.C2H6/c1-6-5-11-8-3-2-7(10)4-9(8)12-6;1-2/h2-4,6H,5H2,1H3;1-2H3 |
| InChIKey | IVBXECRGEQIJNV-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |