About 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine
5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine (PubChem CID 115492937) has the molecular formula C13H19NO2
and a molecular weight of 221.30 g/mol. Its IUPAC name is 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine.
Molecular Properties
| Compound Name | 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine |
| PubChem CID | 115492937 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine |
| SMILES | CCCCc1ccc2c(c1)C(NOC)CO2 |
| InChI | InChI=1S/C13H19NO2/c1-3-4-5-10-6-7-13-11(8-10)12(9-16-13)14-15-2/h6-8,12,14H,3-5,9H2,1-2H3 |
| InChIKey | PNHABCVSHCVANP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine?
The IUPAC name of 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine (CID 115492937) is 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine.
What is the SMILES notation for 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine?
The canonical SMILES for 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine is CCCCc1ccc2c(c1)C(NOC)CO2.
What is the InChIKey of 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine?
The InChIKey is PNHABCVSHCVANP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO2/c1-3-4-5-10-6-7-13-11(8-10)12(9-16-13)14-15-2/h6-8,12,14H,3-5,9H2,1-2H3.
What are the key properties of 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine?
5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine has a molecular weight of 221.30 g/mol, XLogP of 2.61, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butyl-N-methoxy-2,3-dihydro-1-benzofuran-3-amine is sourced from PubChem (CID 115492937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).