C15H20 — CID 10726726
(1S,8R)-4-butyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 10726726) has the molecular formula C15H20 and a molecular weight of 200.32 g/mol. Its IUPAC name is (1S,8R)-4-butyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
| Compound Name | (1S,8R)-4-butyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10726726 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (1S,8R)-4-butyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene |
| SMILES | CCCCc1ccc2c(c1)[C@H]1CC[C@@H]2C1 |
| InChI | InChI=1S/C15H20/c1-2-3-4-11-5-8-14-12-6-7-13(10-12)15(14)9-11/h5,8-9,12-13H,2-4,6-7,10H2,1H3/t12-,13+/m1/s1 |
| InChIKey | AUYKWEJZSSBWEV-OLZOCXBDSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |