About (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene
(1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (PubChem CID 10797293) has the molecular formula C13H16
and a molecular weight of 172.27 g/mol. Its IUPAC name is (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
Analyze (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The IUPAC name of (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene (CID 10797293) is (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene.
What is the SMILES notation for (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The canonical SMILES for (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene is CCc1ccc2c(c1)[C@H]1CC[C@@H]2C1.
What is the InChIKey of (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
The InChIKey is YXTLGGAHWZTMKR-MNOVXSKESA-N. The full InChI is InChI=1S/C13H16/c1-2-9-3-6-12-10-4-5-11(8-10)13(12)7-9/h3,6-7,10-11H,2,4-5,8H2,1H3/t10-,11+/m1/s1.
What are the key properties of (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene?
(1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene has a molecular weight of 172.27 g/mol, XLogP of 3.61, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,8R)-4-ethyltricyclo[6.2.1.02,7]undeca-2(7),3,5-triene is sourced from PubChem (CID 10797293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).