About 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane
4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane (PubChem CID 159281045) has the molecular formula C12H15Br
and a molecular weight of 239.16 g/mol. Its IUPAC name is 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane.
Analyze 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane?
The IUPAC name of 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane (CID 159281045) is 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane.
What is the SMILES notation for 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane?
The canonical SMILES for 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane is Brc1ccc2c(c1)C1CCC2C1.C.
What is the InChIKey of 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane?
The InChIKey is KYXPSIFLIFKRFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Br.CH4/c12-9-3-4-10-7-1-2-8(5-7)11(10)6-9;/h3-4,6-8H,1-2,5H2;1H4.
What are the key properties of 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane?
4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane has a molecular weight of 239.16 g/mol, XLogP of 4.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromotricyclo[6.2.1.02,7]undeca-2(7),3,5-triene;methane is sourced from PubChem (CID 159281045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).