C43H36Br2N2 — CID 142500584
3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)benzene-1,3-diamine (PubChem CID 142500584) has the molecular formula C43H36Br2N2 and a molecular weight of 740.58 g/mol. Its IUPAC name is 3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)benzene-1,3-diamine.
| Compound Name | 3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 142500584 |
| Molecular Formula | C43H36Br2N2 |
| Molecular Weight | 740.58 g/mol |
| Exact Mass | 738.12 |
| IUPAC Name | 3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)benzene-1,3-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc(-c3ccc4c(c3)C3CCC4C3)cc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C43H36Br2N2/c1-28-3-14-36(15-4-28)46(37-16-5-29(2)6-17-37)40-24-33(30-9-22-42-31-7-8-32(23-31)43(42)26-30)25-41(27-40)47(38-18-10-34(44)11-19-38)39-20-12-35(45)13-21-39/h3-6,9-22,24-27,31-32H,7-8,23H2,1-2H3 |
| InChIKey | CIGLMQZTEVYCIP-UHFFFAOYSA-N |
| XLogP | 13.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.58 |
| LogP ≤ 5 | 13.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |