C20H17Br2N — CID 58544695
3,5-dibromo-N,N-bis(4-methylphenyl)aniline (PubChem CID 58544695) has the molecular formula C20H17Br2N and a molecular weight of 431.17 g/mol. Its IUPAC name is 3,5-dibromo-N,N-bis(4-methylphenyl)aniline.
| Compound Name | 3,5-dibromo-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 58544695 |
| Molecular Formula | C20H17Br2N |
| Molecular Weight | 431.17 g/mol |
| Exact Mass | 428.97 |
| IUPAC Name | 3,5-dibromo-N,N-bis(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc(Br)cc(Br)c2)cc1 |
| InChI | InChI=1S/C20H17Br2N/c1-14-3-7-18(8-4-14)23(19-9-5-15(2)6-10-19)20-12-16(21)11-17(22)13-20/h3-13H,1-2H3 |
| InChIKey | AQCATVFOAVNDGG-UHFFFAOYSA-N |
| XLogP | 7.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.17 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |