C45H43Br2N3 — CID 142500563
3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(1,1,2,3,3-pentamethylisoindol-5-yl)benzene-1,3-diamine (PubChem CID 142500563) has the molecular formula C45H43Br2N3 and a molecular weight of 785.67 g/mol. Its IUPAC name is 3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(1,1,2,3,3-pentamethylisoindol-5-yl)benzene-1,3-diamine.
| Compound Name | 3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(1,1,2,3,3-pentamethylisoindol-5-yl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 142500563 |
| Molecular Formula | C45H43Br2N3 |
| Molecular Weight | 785.67 g/mol |
| Exact Mass | 783.18 |
| IUPAC Name | 3-N,3-N-bis(4-bromophenyl)-1-N,1-N-bis(4-methylphenyl)-5-(1,1,2,3,3-pentamethylisoindol-5-yl)benzene-1,3-diamine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2cc(-c3ccc4c(c3)C(C)(C)N(C)C4(C)C)cc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)c2)cc1 |
| InChI | InChI=1S/C45H43Br2N3/c1-30-8-17-36(18-9-30)49(37-19-10-31(2)11-20-37)40-26-33(32-12-25-42-43(28-32)45(5,6)48(7)44(42,3)4)27-41(29-40)50(38-21-13-34(46)14-22-38)39-23-15-35(47)16-24-39/h8-29H,1-7H3 |
| InChIKey | NMAHTVJGGKLTRX-UHFFFAOYSA-N |
| XLogP | 13.85 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.67 |
| LogP ≤ 5 | 13.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |