C31H27Br2F2N — CID 142500772
N,N-bis(4-bromophenyl)-3-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)aniline (PubChem CID 142500772) has the molecular formula C31H27Br2F2N and a molecular weight of 611.37 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-3-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)aniline.
| Compound Name | N,N-bis(4-bromophenyl)-3-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)aniline |
|---|---|
| PubChem CID | 142500772 |
| Molecular Formula | C31H27Br2F2N |
| Molecular Weight | 611.37 g/mol |
| Exact Mass | 609.05 |
| IUPAC Name | N,N-bis(4-bromophenyl)-3-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)aniline |
| SMILES | CC1(C)c2ccc(-c3cccc(N(c4ccc(Br)cc4)c4ccc(Br)cc4)c3)cc2C(C)(C)C1(F)F |
| InChI | InChI=1S/C31H27Br2F2N/c1-29(2)27-17-8-21(19-28(27)30(3,4)31(29,34)35)20-6-5-7-26(18-20)36(24-13-9-22(32)10-14-24)25-15-11-23(33)12-16-25/h5-19H,1-4H3 |
| InChIKey | GJJAIZWGFOGODU-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.37 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |