C44H43F4N — CID 142500552
2,5-bis(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-N,N-diphenylaniline (PubChem CID 142500552) has the molecular formula C44H43F4N and a molecular weight of 661.83 g/mol. Its IUPAC name is 2,5-bis(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-N,N-diphenylaniline.
| Compound Name | 2,5-bis(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 142500552 |
| Molecular Formula | C44H43F4N |
| Molecular Weight | 661.83 g/mol |
| Exact Mass | 661.33 |
| IUPAC Name | 2,5-bis(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)-N,N-diphenylaniline |
| SMILES | CC1(C)c2ccc(-c3ccc(-c4ccc5c(c4)C(C)(C)C(F)(F)C5(C)C)c(N(c4ccccc4)c4ccccc4)c3)cc2C(C)(C)C1(F)F |
| InChI | InChI=1S/C44H43F4N/c1-39(2)34-23-20-28(25-36(34)41(5,6)43(39,45)46)29-19-22-33(30-21-24-35-37(26-30)42(7,8)44(47,48)40(35,3)4)38(27-29)49(31-15-11-9-12-16-31)32-17-13-10-14-18-32/h9-27H,1-8H3 |
| InChIKey | QERGZDONCKSOGR-UHFFFAOYSA-N |
| XLogP | 12.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.83 |
| LogP ≤ 5 | 12.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |