C48H55N — CID 154592918
N,N-diphenyl-2,5-bis(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline (PubChem CID 154592918) has the molecular formula C48H55N and a molecular weight of 652.01 g/mol. Its IUPAC name is N,N-diphenyl-2,5-bis(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline.
| Compound Name | N,N-diphenyl-2,5-bis(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline |
|---|---|
| PubChem CID | 154592918 |
| Molecular Formula | C48H55N |
| Molecular Weight | 652.01 g/mol |
| Exact Mass | 651.47 |
| IUPAC Name | N,N-diphenyl-2,5-bis(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline |
| SMILES | [2H]c1c([2H])c2c(c([2H])c1-c1ccc(-c3c([2H])c([2H])c4c(c3[2H])C(C)(C)C(C)(C)C4(C)C)c(N(c3ccccc3)c3ccccc3)c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C48H55N/c1-43(2)38-27-24-32(29-40(38)45(5,6)47(43,9)10)33-23-26-37(34-25-28-39-41(30-34)46(7,8)48(11,12)44(39,3)4)42(31-33)49(35-19-15-13-16-20-35)36-21-17-14-18-22-36/h13-31H,1-12H3/i24D,25D,27D,28D,29D,30D |
| InChIKey | BIVSCNUHEBGGIM-NSGVEWNBSA-N |
| XLogP | 13.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.01 |
| LogP ≤ 5 | 13.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |