C34H37N — CID 154592981
3-methyl-N,N-diphenyl-4-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline (PubChem CID 154592981) has the molecular formula C34H37N and a molecular weight of 462.70 g/mol. Its IUPAC name is 3-methyl-N,N-diphenyl-4-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline.
| Compound Name | 3-methyl-N,N-diphenyl-4-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline |
|---|---|
| PubChem CID | 154592981 |
| Molecular Formula | C34H37N |
| Molecular Weight | 462.70 g/mol |
| Exact Mass | 462.31 |
| IUPAC Name | 3-methyl-N,N-diphenyl-4-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)aniline |
| SMILES | [2H]c1c([2H])c2c(c([2H])c1-c1ccc(N(c3ccccc3)c3ccccc3)cc1C)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C34H37N/c1-24-22-28(35(26-14-10-8-11-15-26)27-16-12-9-13-17-27)19-20-29(24)25-18-21-30-31(23-25)33(4,5)34(6,7)32(30,2)3/h8-23H,1-7H3/i18D,21D,23D |
| InChIKey | QKLOYSPUDUCLRC-JJMKVQAOSA-N |
| XLogP | 9.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.70 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |