C44H43N — CID 142500621
2,5-bis(1,8-dimethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-N,N-diphenylaniline (PubChem CID 142500621) has the molecular formula C44H43N and a molecular weight of 585.84 g/mol. Its IUPAC name is 2,5-bis(1,8-dimethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-N,N-diphenylaniline.
| Compound Name | 2,5-bis(1,8-dimethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 142500621 |
| Molecular Formula | C44H43N |
| Molecular Weight | 585.84 g/mol |
| Exact Mass | 585.34 |
| IUPAC Name | 2,5-bis(1,8-dimethyl-4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl)-N,N-diphenylaniline |
| SMILES | CC12CCC(C)(C1)c1cc(-c3ccc(-c4ccc5c(c4)C4(C)CCC5(C)C4)c(N(c4ccccc4)c4ccccc4)c3)ccc12 |
| InChI | InChI=1S/C44H43N/c1-41-21-23-43(3,28-41)38-25-30(16-19-36(38)41)31-15-18-35(32-17-20-37-39(26-32)44(4)24-22-42(37,2)29-44)40(27-31)45(33-11-7-5-8-12-33)34-13-9-6-10-14-34/h5-20,25-27H,21-24,28-29H2,1-4H3 |
| InChIKey | MWUYOMPJDASAED-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.84 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |