C35H41N — CID 142500208
ethane;3-(1,1,2,2,3,3-hexamethylinden-5-yl)-N,N-diphenylaniline (PubChem CID 142500208) has the molecular formula C35H41N and a molecular weight of 475.72 g/mol. Its IUPAC name is ethane;3-(1,1,2,2,3,3-hexamethylinden-5-yl)-N,N-diphenylaniline.
| Compound Name | ethane;3-(1,1,2,2,3,3-hexamethylinden-5-yl)-N,N-diphenylaniline |
|---|---|
| PubChem CID | 142500208 |
| Molecular Formula | C35H41N |
| Molecular Weight | 475.72 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | ethane;3-(1,1,2,2,3,3-hexamethylinden-5-yl)-N,N-diphenylaniline |
| SMILES | CC.CC1(C)c2ccc(-c3cccc(N(c4ccccc4)c4ccccc4)c3)cc2C(C)(C)C1(C)C |
| InChI | InChI=1S/C33H35N.C2H6/c1-31(2)29-21-20-25(23-30(29)32(3,4)33(31,5)6)24-14-13-19-28(22-24)34(26-15-9-7-10-16-26)27-17-11-8-12-18-27;1-2/h7-23H,1-6H3;1-2H3 |
| InChIKey | MHYORNLMTUUZNI-UHFFFAOYSA-N |
| XLogP | 10.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.72 |
| LogP ≤ 5 | 10.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |