C60H62F2N2 — CID 142500793
1-N,3-N-bis[3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine (PubChem CID 142500793) has the molecular formula C60H62F2N2 and a molecular weight of 849.17 g/mol. Its IUPAC name is 1-N,3-N-bis[3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine.
| Compound Name | 1-N,3-N-bis[3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 142500793 |
| Molecular Formula | C60H62F2N2 |
| Molecular Weight | 849.17 g/mol |
| Exact Mass | 848.49 |
| IUPAC Name | 1-N,3-N-bis[3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)phenyl]-1-N,3-N-diphenylbenzene-1,3-diamine |
| SMILES | CC1(C)c2cc(-c3cccc(N(c4ccccc4)c4cccc(N(c5ccccc5)c5cccc(-c6cc(F)c7c(c6)C(C)(C)C(C)(C)C7(C)C)c5)c4)c3)cc(F)c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C60H62F2N2/c1-55(2)49-34-41(36-51(61)53(49)57(5,6)59(55,9)10)39-22-19-28-45(32-39)63(43-24-15-13-16-25-43)47-30-21-31-48(38-47)64(44-26-17-14-18-27-44)46-29-20-23-40(33-46)42-35-50-54(52(62)37-42)58(7,8)60(11,12)56(50,3)4/h13-38H,1-12H3 |
| InChIKey | APXIZFIHELEKDE-UHFFFAOYSA-N |
| XLogP | 17.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.17 |
| LogP ≤ 5 | 17.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |