C37H34Br2FN — CID 147984412
N,N-bis(4-bromophenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)naphthalen-1-amine (PubChem CID 147984412) has the molecular formula C37H34Br2FN and a molecular weight of 671.49 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)naphthalen-1-amine.
| Compound Name | N,N-bis(4-bromophenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)naphthalen-1-amine |
|---|---|
| PubChem CID | 147984412 |
| Molecular Formula | C37H34Br2FN |
| Molecular Weight | 671.49 g/mol |
| Exact Mass | 669.10 |
| IUPAC Name | N,N-bis(4-bromophenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)naphthalen-1-amine |
| SMILES | CC1(C)c2cc(-c3ccc(N(c4ccc(Br)cc4)c4ccc(Br)cc4)c4ccccc34)cc(F)c2C(C)(C)C1(C)C |
| InChI | InChI=1S/C37H34Br2FN/c1-35(2)31-21-23(22-32(40)34(31)36(3,4)37(35,5)6)28-19-20-33(30-10-8-7-9-29(28)30)41(26-15-11-24(38)12-16-26)27-17-13-25(39)14-18-27/h7-22H,1-6H3 |
| InChIKey | ITVXFLLMAWEGSM-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.49 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |