C34H38FN — CID 142500116
N-cyclohexa-1,5-dien-1-yl-3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N-phenylaniline (PubChem CID 142500116) has the molecular formula C34H38FN and a molecular weight of 479.68 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N-phenylaniline.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 142500116 |
| Molecular Formula | C34H38FN |
| Molecular Weight | 479.68 g/mol |
| Exact Mass | 479.30 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-3-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-4-methyl-N-phenylaniline |
| SMILES | Cc1ccc(N(C2=CCCC=C2)c2ccccc2)cc1-c1cc(F)c2c(c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C34H38FN/c1-23-18-19-27(36(25-14-10-8-11-15-25)26-16-12-9-13-17-26)22-28(23)24-20-29-31(30(35)21-24)33(4,5)34(6,7)32(29,2)3/h8,10-12,14-22H,9,13H2,1-7H3 |
| InChIKey | IJPPKNZALCCLOU-UHFFFAOYSA-N |
| XLogP | 9.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.68 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |