C41H42FN — CID 142500838
N-cyclohexa-1,5-dien-1-yl-2,3-bis(ethenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-N-phenylnaphthalen-1-amine (PubChem CID 142500838) has the molecular formula C41H42FN and a molecular weight of 567.79 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-2,3-bis(ethenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-N-phenylnaphthalen-1-amine.
| Compound Name | N-cyclohexa-1,5-dien-1-yl-2,3-bis(ethenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-N-phenylnaphthalen-1-amine |
|---|---|
| PubChem CID | 142500838 |
| Molecular Formula | C41H42FN |
| Molecular Weight | 567.79 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-2,3-bis(ethenyl)-4-(7-fluoro-1,1,2,2,3,3-hexamethylinden-5-yl)-N-phenylnaphthalen-1-amine |
| SMILES | C=Cc1c(C=C)c(N(C2=CCCC=C2)c2ccccc2)c2ccccc2c1-c1cc(F)c2c(c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C41H42FN/c1-9-30-31(10-2)38(43(28-19-13-11-14-20-28)29-21-15-12-16-22-29)33-24-18-17-23-32(33)36(30)27-25-34-37(35(42)26-27)40(5,6)41(7,8)39(34,3)4/h9-11,13-15,17-26H,1-2,12,16H2,3-8H3 |
| InChIKey | VNRCTOCBYIQHCT-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.79 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |