C38H41Br2N — CID 142500271
N,N-bis(4-bromophenyl)-2-(2,2,3,3,4,5,5,6,6-nonamethyl-9-tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trienyl)aniline (PubChem CID 142500271) has the molecular formula C38H41Br2N and a molecular weight of 671.56 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-2-(2,2,3,3,4,5,5,6,6-nonamethyl-9-tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trienyl)aniline.
| Compound Name | N,N-bis(4-bromophenyl)-2-(2,2,3,3,4,5,5,6,6-nonamethyl-9-tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trienyl)aniline |
|---|---|
| PubChem CID | 142500271 |
| Molecular Formula | C38H41Br2N |
| Molecular Weight | 671.56 g/mol |
| Exact Mass | 669.16 |
| IUPAC Name | N,N-bis(4-bromophenyl)-2-(2,2,3,3,4,5,5,6,6-nonamethyl-9-tricyclo[5.3.1.04,11]undeca-1(10),7(11),8-trienyl)aniline |
| SMILES | CC1(C)c2cc(-c3ccccc3N(c3ccc(Br)cc3)c3ccc(Br)cc3)cc3c2C(C)(C1(C)C)C(C)(C)C3(C)C |
| InChI | InChI=1S/C38H41Br2N/c1-34(2)30-22-24(23-31-33(30)38(9,36(34,5)6)37(7,8)35(31,3)4)29-12-10-11-13-32(29)41(27-18-14-25(39)15-19-27)28-20-16-26(40)17-21-28/h10-23H,1-9H3 |
| InChIKey | PUXABZKBVZPUDZ-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.56 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |