C33H35N — CID 154592827
2-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]-N,N-diphenylaniline (PubChem CID 154592827) has the molecular formula C33H35N and a molecular weight of 463.76 g/mol. Its IUPAC name is 2-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]-N,N-diphenylaniline.
| Compound Name | 2-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 154592827 |
| Molecular Formula | C33H35N |
| Molecular Weight | 463.76 g/mol |
| Exact Mass | 463.39 |
| IUPAC Name | 2-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]-N,N-diphenylaniline |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccc(-c3ccccc3N(c3ccccc3)c3ccccc3)cc2C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C1(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C33H35N/c1-31(2)28-22-21-24(23-29(28)32(3,4)33(31,5)6)27-19-13-14-20-30(27)34(25-15-9-7-10-16-25)26-17-11-8-12-18-26/h7-23H,1-6H3/i1D3,2D3,3D3,4D3,5D3,6D3 |
| InChIKey | JAOOSMCTBYHHLR-NBDUPMGQSA-N |
| XLogP | 9.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.76 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |