C35H37Br2N — CID 154592954
4-bromo-N-(4-bromo-2-methylphenyl)-N-[4-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]phenyl]-2-methylaniline (PubChem CID 154592954) has the molecular formula C35H37Br2N and a molecular weight of 649.61 g/mol. Its IUPAC name is 4-bromo-N-(4-bromo-2-methylphenyl)-N-[4-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]phenyl]-2-methylaniline.
| Compound Name | 4-bromo-N-(4-bromo-2-methylphenyl)-N-[4-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]phenyl]-2-methylaniline |
|---|---|
| PubChem CID | 154592954 |
| Molecular Formula | C35H37Br2N |
| Molecular Weight | 649.61 g/mol |
| Exact Mass | 647.24 |
| IUPAC Name | 4-bromo-N-(4-bromo-2-methylphenyl)-N-[4-[1,1,2,2,3,3-hexakis(trideuteriomethyl)inden-5-yl]phenyl]-2-methylaniline |
| SMILES | [2H]C([2H])([2H])C1(C([2H])([2H])[2H])c2ccc(-c3ccc(N(c4ccc(Br)cc4C)c4ccc(Br)cc4C)cc3)cc2C(C([2H])([2H])[2H])(C([2H])([2H])[2H])C1(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C35H37Br2N/c1-22-19-26(36)12-17-31(22)38(32-18-13-27(37)20-23(32)2)28-14-9-24(10-15-28)25-11-16-29-30(21-25)34(5,6)35(7,8)33(29,3)4/h9-21H,1-8H3/i3D3,4D3,5D3,6D3,7D3,8D3 |
| InChIKey | NGCMIBGBWQECOC-KJWDNGDUSA-N |
| XLogP | 11.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.61 |
| LogP ≤ 5 | 11.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |