C80H88F4N2 — CID 154592904
2-N,7-N-bis[2-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)phenyl]-9,10-dioctyl-2-N,7-N-diphenylphenanthrene-2,7-diamine (PubChem CID 154592904) has the molecular formula C80H88F4N2 and a molecular weight of 1153.59 g/mol. Its IUPAC name is 2-N,7-N-bis[2-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)phenyl]-9,10-dioctyl-2-N,7-N-diphenylphenanthrene-2,7-diamine.
| Compound Name | 2-N,7-N-bis[2-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)phenyl]-9,10-dioctyl-2-N,7-N-diphenylphenanthrene-2,7-diamine |
|---|---|
| PubChem CID | 154592904 |
| Molecular Formula | C80H88F4N2 |
| Molecular Weight | 1153.59 g/mol |
| Exact Mass | 1152.69 |
| IUPAC Name | 2-N,7-N-bis[2-(2,2-difluoro-1,1,3,3-tetramethylinden-5-yl)phenyl]-9,10-dioctyl-2-N,7-N-diphenylphenanthrene-2,7-diamine |
| SMILES | CCCCCCCCc1c(CCCCCCCC)c2cc(N(c3ccccc3)c3ccccc3-c3ccc4c(c3)C(C)(C)C(F)(F)C4(C)C)ccc2c2ccc(N(c3ccccc3)c3ccccc3-c3ccc4c(c3)C(C)(C)C(F)(F)C4(C)C)cc12 |
| InChI | InChI=1S/C80H88F4N2/c1-11-13-15-17-19-27-39-63-64(40-28-20-18-16-14-12-2)68-54-60(86(58-35-25-22-26-36-58)74-42-32-30-38-62(74)56-44-50-70-72(52-56)78(9,10)80(83,84)76(70,5)6)46-48-66(68)65-47-45-59(53-67(63)65)85(57-33-23-21-24-34-57)73-41-31-29-37-61(73)55-43-49-69-71(51-55)77(7,8)79(81,82)75(69,3)4/h21-26,29-38,41-54H,11-20,27-28,39-40H2,1-10H3 |
| InChIKey | ZFHDOMBQLILVEM-UHFFFAOYSA-N |
| XLogP | 24.48 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1153.59 |
| LogP ≤ 5 | 24.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|