C39H35Br2NO — CID 154592939
N,N-bis(4-bromophenyl)-2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)dibenzofuran-4-amine (PubChem CID 154592939) has the molecular formula C39H35Br2NO and a molecular weight of 696.54 g/mol. Its IUPAC name is N,N-bis(4-bromophenyl)-2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)dibenzofuran-4-amine.
| Compound Name | N,N-bis(4-bromophenyl)-2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)dibenzofuran-4-amine |
|---|---|
| PubChem CID | 154592939 |
| Molecular Formula | C39H35Br2NO |
| Molecular Weight | 696.54 g/mol |
| Exact Mass | 694.13 |
| IUPAC Name | N,N-bis(4-bromophenyl)-2-(4,6,7-trideuterio-1,1,2,2,3,3-hexamethylinden-5-yl)dibenzofuran-4-amine |
| SMILES | [2H]c1c([2H])c2c(c([2H])c1-c1cc(N(c3ccc(Br)cc3)c3ccc(Br)cc3)c3oc4ccccc4c3c1)C(C)(C)C(C)(C)C2(C)C |
| InChI | InChI=1S/C39H35Br2NO/c1-37(2)32-20-11-24(22-33(32)38(3,4)39(37,5)6)25-21-31-30-9-7-8-10-35(30)43-36(31)34(23-25)42(28-16-12-26(40)13-17-28)29-18-14-27(41)15-19-29/h7-23H,1-6H3/i11D,20D,22D |
| InChIKey | BALGUTCNUIBZKC-SQZIFOJISA-N |
| XLogP | 12.84 |
| TPSA | 16.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.54 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |