C46H28F8N2O2 — CID 142500795
1-N,3-N-diphenyl-1-N,3-N-bis[3-(1,1,3,3-tetrafluoro-2-benzofuran-5-yl)phenyl]benzene-1,3-diamine (PubChem CID 142500795) has the molecular formula C46H28F8N2O2 and a molecular weight of 792.73 g/mol. Its IUPAC name is 1-N,3-N-diphenyl-1-N,3-N-bis[3-(1,1,3,3-tetrafluoro-2-benzofuran-5-yl)phenyl]benzene-1,3-diamine.
| Compound Name | 1-N,3-N-diphenyl-1-N,3-N-bis[3-(1,1,3,3-tetrafluoro-2-benzofuran-5-yl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 142500795 |
| Molecular Formula | C46H28F8N2O2 |
| Molecular Weight | 792.73 g/mol |
| Exact Mass | 792.20 |
| IUPAC Name | 1-N,3-N-diphenyl-1-N,3-N-bis[3-(1,1,3,3-tetrafluoro-2-benzofuran-5-yl)phenyl]benzene-1,3-diamine |
| SMILES | FC1(F)OC(F)(F)c2cc(-c3cccc(N(c4ccccc4)c4cccc(N(c5ccccc5)c5cccc(-c6ccc7c(c6)C(F)(F)OC7(F)F)c5)c4)c3)ccc21 |
| InChI | InChI=1S/C46H28F8N2O2/c47-43(48)39-22-20-31(26-41(39)45(51,52)57-43)29-10-7-16-35(24-29)55(33-12-3-1-4-13-33)37-18-9-19-38(28-37)56(34-14-5-2-6-15-34)36-17-8-11-30(25-36)32-21-23-40-42(27-32)46(53,54)58-44(40,49)50/h1-28H |
| InChIKey | YXKFPNURALVCDV-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 792.73 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |